ChemNet > CAS > 827-15-6 iodopentafluorobenzene
827-15-6 iodopentafluorobenzene
उत्पाद का नाम |
iodopentafluorobenzene |
समानार्थी |
Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene |
आणविक फार्मूला |
C6F5I |
आण्विक वजन |
293.9607 |
InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
कैस रजिस्टी संख्या |
827-15-6 |
EINECS |
212-565-2 |
आणविक संरचना |
|
घनत्व |
2.217g/cm3 |
उबलने का समय |
166.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.502 |
फ्लैश प्वाइंट |
61.3°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|