ChemNet > CAS > 827-15-6 iodopentafluorobenzene
827-15-6 iodopentafluorobenzene
| उत्पाद का नाम |
iodopentafluorobenzene |
| समानार्थी |
Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene |
| आणविक फार्मूला |
C6F5I |
| आण्विक वजन |
293.9607 |
| InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| कैस रजिस्टी संख्या |
827-15-6 |
| EINECS |
212-565-2 |
| आणविक संरचना |
|
| घनत्व |
2.217g/cm3 |
| उबलने का समय |
166.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.502 |
| फ्लैश प्वाइंट |
61.3°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
