ChemNet > CAS > 99-42-3 Methyl 4-hydroxy-3-nitrobenzoate
99-42-3 Methyl 4-hydroxy-3-nitrobenzoate
| उत्पाद का नाम |
Methyl 4-hydroxy-3-nitrobenzoate |
| समानार्थी |
4-Hydroxy-3-nitrobenzoic acid methyl ester; Methyl 3-nitro-4-hydroxybenzoate; 4-(methoxycarbonyl)-2-nitrophenolate; 3-nitro-4-hydroxymethyl benzoate |
| आणविक फार्मूला |
C8H6NO5 |
| आण्विक वजन |
196.1375 |
| InChI |
InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
| कैस रजिस्टी संख्या |
99-42-3 |
| EINECS |
202-755-3 |
| आणविक संरचना |
|
| गलनांक |
74-76℃ |
| उबलने का समय |
311.1°C at 760 mmHg |
| फ्लैश प्वाइंट |
141.9°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
