ChemNet > CAS > 13524-04-4 1-(2-Chlorophenyl)ethanol
13524-04-4 1-(2-Chlorophenyl)ethanol
نام محصول |
1-(2-Chlorophenyl)ethanol |
مترادف |
2-Chloro-alpha-methylbenzyl alcohol; (1S)-1-(2-chlorophenyl)ethanol; (1R)-1-(2-chlorophenyl)ethanol |
میدان مغناطیسی |
C8H9ClO |
وزن مولکولی |
156.6095 |
InChI |
InChI=1/C8H9ClO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3/t6-/m1/s1 |
شماره سیایاس |
13524-04-4 |
تعداد کمیسیون اروپایی |
236-868-4 |
ساختار مولکولی |
|
تراکم |
1.182g/cm3 |
نقطه غلیان |
231.4°C at 760 mmHg |
ضریب شکست |
1.55 |
نقطه اشتعال |
93.8°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|