ChemNet > CAS > 145240-28-4 4-n-Butylbenzeneboronic acid
145240-28-4 4-n-Butylbenzeneboronic acid
نام محصول |
4-n-Butylbenzeneboronic acid |
نام انگلیسی |
4-n-Butylbenzeneboronic acid; 4-n-Butylphenylboronic acid; 4-Butylphenylboronic acid; (4-butylphenyl)boronic acid |
میدان مغناطیسی |
C10H15BO2 |
وزن مولکولی |
178.0359 |
InChI |
InChI=1/C10H15BO2/c1-2-3-4-9-5-7-10(8-6-9)11(12)13/h5-8,12-13H,2-4H2,1H3 |
شماره سیایاس |
145240-28-4 |
ساختار مولکولی |
|
تراکم |
1.03g/cm3 |
نقطه ذوب |
91-97℃ |
نقطه غلیان |
313.5°C at 760 mmHg |
ضریب شکست |
1.512 |
نقطه اشتعال |
143.4°C |
فشار بخار |
0.00021mmHg at 25°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|