1590-08-5 2-Methyl-1-tetralone
نام محصول |
2-Methyl-1-tetralone |
نام انگلیسی |
2-Methyl-1-tetralone; 1,2,3,4-tetrahydro-2-methylnaphthalen-1-one; 2-methyl-3,4-dihydronaphthalen-1(2H)-one; (2R)-2-methyl-3,4-dihydronaphthalen-1(2H)-one; (2S)-2-methyl-3,4-dihydronaphthalen-1(2H)-one |
میدان مغناطیسی |
C11H12O |
وزن مولکولی |
160.2124 |
InChI |
InChI=1/C11H12O/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-5,8H,6-7H2,1H3/t8-/m0/s1 |
شماره سیایاس |
1590-08-5 |
تعداد کمیسیون اروپایی |
216-461-8 |
ساختار مولکولی |
|
تراکم |
1.048g/cm3 |
نقطه غلیان |
262.3°C at 760 mmHg |
ضریب شکست |
1.539 |
نقطه اشتعال |
107°C |
فشار بخار |
0.011mmHg at 25°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|