ChemNet > CAS > 175203-08-4 4-(4-chlorophenyl)pyrimidine-2-thiol
175203-08-4 4-(4-chlorophenyl)pyrimidine-2-thiol
نام محصول |
4-(4-chlorophenyl)pyrimidine-2-thiol |
نام انگلیسی |
4-(4-chlorophenyl)pyrimidine-2-thiol;6-(4-chlorophenyl)pyrimidine-2(1H)-thione; 4-(4-Chlorophenyl)-2-mercaptopyrimidine |
میدان مغناطیسی |
C10H7ClN2S |
وزن مولکولی |
222.694 |
InChI |
InChI=1/C10H7ClN2S/c11-8-3-1-7(2-4-8)9-5-6-12-10(14)13-9/h1-6H,(H,12,13,14) |
شماره سیایاس |
175203-08-4 |
ساختار مولکولی |
|
تراکم |
1.35g/cm3 |
نقطه ذوب |
220℃ |
نقطه غلیان |
357.1°C at 760 mmHg |
ضریب شکست |
1.674 |
نقطه اشتعال |
169.8°C |
فشار بخار |
2.79E-05mmHg at 25°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|