ChemNet > CAS > 1877-73-2 3-Nitrophenylacetic acid
1877-73-2 3-Nitrophenylacetic acid
نام محصول |
3-Nitrophenylacetic acid |
نام انگلیسی |
3-Nitrophenylacetic acid; (3-nitrophenyl)acetic acid; (3-nitrophenyl)acetate; m-Nitrophenylacetic acid; (3-nitrophenyl) acetic acid |
میدان مغناطیسی |
C8H6NO4 |
وزن مولکولی |
180.1381 |
InChI |
InChI=1/C8H7NO4/c10-8(11)5-6-2-1-3-7(4-6)9(12)13/h1-4H,5H2,(H,10,11)/p-1 |
شماره سیایاس |
1877-73-2 |
تعداد کمیسیون اروپایی |
217-512-7 |
ساختار مولکولی |
|
نقطه ذوب |
116-120℃ |
نقطه غلیان |
373.8°C at 760 mmHg |
نقطه اشتعال |
169.8°C |
فشار بخار |
2.98E-06mmHg at 25°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|