ChemNet > CAS > 206559-44-6 2-(5-Bromo-2-methoxyphenyl)ethylamine hydrobromide
206559-44-6 2-(5-Bromo-2-methoxyphenyl)ethylamine hydrobromide
نام محصول |
2-(5-Bromo-2-methoxyphenyl)ethylamine hydrobromide |
مترادف |
5-Bromo-2-methoxyphenethylamine hydrobromide; 2-(5-bromo-2-methoxyphenyl)ethanaminium bromide |
میدان مغناطیسی |
C9H13Br2NO |
وزن مولکولی |
311.0136 |
InChI |
InChI=1/C9H12BrNO.BrH/c1-12-9-3-2-8(10)6-7(9)4-5-11;/h2-3,6H,4-5,11H2,1H3;1H |
شماره سیایاس |
206559-44-6 |
ساختار مولکولی |
|
نقطه غلیان |
296.9°C at 760 mmHg |
نقطه اشتعال |
133.3°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|