ChemNet > CAS > 2393-17-1 Aminohydrocinnamicacid
2393-17-1 Aminohydrocinnamicacid
نام محصول |
Aminohydrocinnamicacid |
مترادف |
4-Aminohydrocinnamic acid; 3-(4-aminophenyl)propanoic acid |
میدان مغناطیسی |
C9H11NO2 |
وزن مولکولی |
165.1891 |
InChI |
InChI=1/C9H11NO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6,10H2,(H,11,12) |
شماره سیایاس |
2393-17-1 |
تعداد کمیسیون اروپایی |
219-245-1 |
ساختار مولکولی |
|
تراکم |
1.217g/cm3 |
نقطه غلیان |
351°C at 760 mmHg |
ضریب شکست |
1.597 |
نقطه اشتعال |
166.1°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|