ChemNet > CAS > 32556-71-1 (S)-1-Octyn-3-ol
32556-71-1 (S)-1-Octyn-3-ol
| نام محصول |
(S)-1-Octyn-3-ol |
| مترادف |
Octynol; (S)-(-)-1-Octyn-3-ol; (3S)-oct-1-yn-3-ol |
| میدان مغناطیسی |
C8H14O |
| وزن مولکولی |
126.1962 |
| InChI |
InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h2,8-9H,3,5-7H2,1H3/t8-/m1/s1 |
| شماره سیایاس |
32556-71-1 |
| تعداد کمیسیون اروپایی |
212-455-4 |
| ساختار مولکولی |
|
| تراکم |
0.887g/cm3 |
| نقطه غلیان |
169.6°C at 760 mmHg |
| ضریب شکست |
1.452 |
| نقطه اشتعال |
63.9°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
