ChemNet > CAS > 3612-16-6 1-Ethyl-3-methyl-4-piperidone
3612-16-6 1-Ethyl-3-methyl-4-piperidone
نام محصول |
1-Ethyl-3-methyl-4-piperidone |
مترادف |
1-ethyl-3-methylpiperidin-4-one |
میدان مغناطیسی |
C8H15NO |
وزن مولکولی |
141.2108 |
InChI |
InChI=1/C8H15NO/c1-3-9-5-4-8(10)7(2)6-9/h7H,3-6H2,1-2H3 |
شماره سیایاس |
3612-16-6 |
ساختار مولکولی |
|
تراکم |
0.931g/cm3 |
نقطه غلیان |
212.3°C at 760 mmHg |
ضریب شکست |
1.45 |
نقطه اشتعال |
76.2°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|