ChemNet > CAS > 4160-63-8 2-(4-Methoxybenzoyl)thiophene
4160-63-8 2-(4-Methoxybenzoyl)thiophene
نام محصول |
2-(4-Methoxybenzoyl)thiophene |
نام انگلیسی |
2-(4-Methoxybenzoyl)thiophene; p-anisyl thiophen-2-yl ketone; (4-methoxyphenyl)(thiophen-2-yl)methanone; (4-methylphenyl)(thiophen-2-yl)methanone |
میدان مغناطیسی |
C12H10OS |
وزن مولکولی |
202.2722 |
InChI |
InChI=1/C12H10OS/c1-9-4-6-10(7-5-9)12(13)11-3-2-8-14-11/h2-8H,1H3 |
شماره سیایاس |
4160-63-8 |
تعداد کمیسیون اروپایی |
223-997-6 |
ساختار مولکولی |
|
تراکم |
1.167g/cm3 |
نقطه ذوب |
73-76℃ |
نقطه غلیان |
340.6°C at 760 mmHg |
ضریب شکست |
1.599 |
نقطه اشتعال |
159.8°C |
فشار بخار |
8.52E-05mmHg at 25°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|