ChemNet > CAS > 42106-48-9 2-morpholinobenzoic acid
42106-48-9 2-morpholinobenzoic acid
نام محصول |
2-morpholinobenzoic acid |
مترادف |
2-morpholin-4-ylbenzoic acid |
میدان مغناطیسی |
C11H13NO3 |
وزن مولکولی |
207.2258 |
InChI |
InChI=1/C11H13NO3/c13-11(14)9-3-1-2-4-10(9)12-5-7-15-8-6-12/h1-4H,5-8H2,(H,13,14) |
شماره سیایاس |
42106-48-9 |
ساختار مولکولی |
|
تراکم |
1.253g/cm3 |
نقطه ذوب |
157℃ |
نقطه غلیان |
387.5°C at 760 mmHg |
ضریب شکست |
1.579 |
نقطه اشتعال |
188.2°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|