ChemNet > CAS > 50451-84-8 5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid
50451-84-8 5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid
نام محصول |
5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid |
نام انگلیسی |
5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid; |
میدان مغناطیسی |
C10H7ClO2S |
وزن مولکولی |
226.6794 |
InChI |
InChI=1/C10H7ClO2S/c1-5-7-4-6(11)2-3-8(7)14-9(5)10(12)13/h2-4H,1H3,(H,12,13) |
شماره سیایاس |
50451-84-8 |
ساختار مولکولی |
|
تراکم |
1.474g/cm3 |
نقطه ذوب |
298℃ |
نقطه غلیان |
411.7°C at 760 mmHg |
ضریب شکست |
1.695 |
نقطه اشتعال |
202.8°C |
فشار بخار |
1.62E-07mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|