ChemNet > CAS > 5081-37-8 Methyl 3-methoxy-4-nitrobenzoate
5081-37-8 Methyl 3-methoxy-4-nitrobenzoate
نام محصول |
Methyl 3-methoxy-4-nitrobenzoate |
نام انگلیسی |
Methyl 3-methoxy-4-nitrobenzoate; 3-Methoxy-4-nitrobenzoic acid methyl ester; acid methyl ester |
میدان مغناطیسی |
C9H9NO5 |
وزن مولکولی |
211.1715 |
InChI |
InChI=1/C9H9NO5/c1-14-8-5-6(9(11)15-2)3-4-7(8)10(12)13/h3-5H,1-2H3 |
شماره سیایاس |
5081-37-8 |
ساختار مولکولی |
|
تراکم |
1.294g/cm3 |
نقطه ذوب |
86-88℃ |
نقطه غلیان |
350.7°C at 760 mmHg |
ضریب شکست |
1.54 |
نقطه اشتعال |
168.3°C |
فشار بخار |
4.3E-05mmHg at 25°C |
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|