ChemNet > CAS > 527-31-1 Hexaketocyclohexane octahydrate
527-31-1 Hexaketocyclohexane octahydrate
| نام محصول |
Hexaketocyclohexane octahydrate |
| مترادف |
cyclohexanehexaone; Trquinoylhydrate; Hexaoxocyclohexane octahydrate; Triquinolyl octahydrate; Cyclohexanehexone; Trquinoyl; cyclohexane-1,2,3,4,5,6-hexone; cyclohexane-1,2,3,4,5,6-hexone octahydrate; cyclohexane-1,2,3,4,5,6-hexaone Octahydrate |
| میدان مغناطیسی |
C6H16O14 |
| وزن مولکولی |
312.1828 |
| InChI |
InChI=1/C6O6.8H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;;;;;;/h;8*1H2 |
| شماره سیایاس |
527-31-1 |
| تعداد کمیسیون اروپایی |
208-412-4 |
| ساختار مولکولی |
|
| نقطه ذوب |
90-93℃ |
| نقطه غلیان |
344.7°C at 760 mmHg |
| نقطه اشتعال |
152°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21:Harmful by inhalation and in contact with skin.;
|
| توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
