ChemNet > CAS > 602-00-6 3-Hydroxy-2-nitrobenzoic acid
602-00-6 3-Hydroxy-2-nitrobenzoic acid
نام محصول |
3-Hydroxy-2-nitrobenzoic acid |
میدان مغناطیسی |
C7H5NO5 |
وزن مولکولی |
183.1183 |
InChI |
InChI=1/C7H5NO5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H,(H,10,11) |
شماره سیایاس |
602-00-6 |
ساختار مولکولی |
|
تراکم |
1.631g/cm3 |
نقطه غلیان |
362.9°C at 760 mmHg |
ضریب شکست |
1.663 |
نقطه اشتعال |
166.7°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|