ChemNet > CAS > 636-70-4 Triethylamine hydrobromide
636-70-4 Triethylamine hydrobromide
نام محصول |
Triethylamine hydrobromide |
مترادف |
triethylammonium bromide |
میدان مغناطیسی |
C6H15N.HBr |
وزن مولکولی |
182.10 |
InChI |
InChI=1/C6H15N.BrH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
شماره سیایاس |
636-70-4 |
تعداد کمیسیون اروپایی |
211-263-8 |
ساختار مولکولی |
|
نقطه ذوب |
246-248℃ |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|