ChemNet > CAS > 74470-23-8 2-(Methylthio)nicotinic acid
74470-23-8 2-(Methylthio)nicotinic acid
نام محصول |
2-(Methylthio)nicotinic acid |
مترادف |
2-(Methylmercapto)pyridine-3-carboxylic acid~2-(Methylthio)pyridine-3-carboxylic acid; 2-(Methylmercapto)-nicotinic acid; 2-(methylsulfanyl)pyridine-3-carboxylic acid; 2-(methylsulfanyl)pyridine-3-carboxylate |
میدان مغناطیسی |
C7H6NO2S |
وزن مولکولی |
168.1936 |
InChI |
InChI=1/C7H7NO2S/c1-11-6-5(7(9)10)3-2-4-8-6/h2-4H,1H3,(H,9,10)/p-1 |
شماره سیایاس |
74470-23-8 |
ساختار مولکولی |
|
نقطه ذوب |
214-218℃ |
نقطه غلیان |
329.6°C at 760 mmHg |
نقطه اشتعال |
153.2°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|