ChemNet > CAS > 923-06-8 DL-Bromosuccinic acid
923-06-8 DL-Bromosuccinic acid
نام محصول |
DL-Bromosuccinic acid |
مترادف |
Bromobutanedioic acid; Bromosuccinic Acid; 2-bromobutanedioic acid; (2R)-2-bromobutanedioate; (2S)-2-bromobutanedioate |
میدان مغناطیسی |
C4H3BrO4 |
وزن مولکولی |
194.9693 |
InChI |
InChI=1/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m0/s1 |
شماره سیایاس |
923-06-8 |
تعداد کمیسیون اروپایی |
213-087-7 |
ساختار مولکولی |
|
نقطه ذوب |
160-162℃ |
نقطه غلیان |
255.1°C at 760 mmHg |
نقطه اشتعال |
108.1°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|