ChemNet > CAS > 93-65-2 2-(4-Chloro-2-methylphenoxy)propionic acid
93-65-2 2-(4-Chloro-2-methylphenoxy)propionic acid
نام محصول |
2-(4-Chloro-2-methylphenoxy)propionic acid |
مترادف |
2-(4-Chloro-o-tolyloxy)propionic acid; MCPP; Mecoprop; (-)-2-(4-chloro-o-tolyloxy)propionic acid; (2S)-2-(4-chloro-2-methylphenoxy)propanoic acid |
میدان مغناطیسی |
C10H11ClO3 |
وزن مولکولی |
214.6455 |
InChI |
InChI=1/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)/t7-/m0/s1 |
شماره سیایاس |
93-65-2 |
تعداد کمیسیون اروپایی |
202-264-4;230-386-8 [1] |
ساختار مولکولی |
|
تراکم |
1.265g/cm3 |
نقطه غلیان |
331.9°C at 760 mmHg |
ضریب شکست |
1.542 |
نقطه اشتعال |
154.5°C |
حلالیت آب |
734 mg l-1 |
خطر نمادها |
|
کدهای خطر |
R22:Harmful if swallowed.;
R38:Irritating to skin.;
R41:Risks of serious damage to eyes.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|