ChemNet > CAS > 34420-17-2 2-Phenylethyl-1-boronic acid
34420-17-2 2-Phenylethyl-1-boronic acid
| Nome del prodotto |
2-Phenylethyl-1-boronic acid |
| Sinonimi |
Phenethylboronic acid; (2-phenylethyl)boronic acid; [(E)-2-phenylethenyl]boronic acid; 2-Phenylethaneboronic acid; Phenylethaneboronic Acid |
| Formula molecolare |
C8H9BO2 |
| Peso Molecolare |
147.9669 |
| InChI |
InChI=1/C8H9BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,10-11H/b7-6+ |
| Numero CAS |
34420-17-2 |
| Struttura molecolare |
|
| Densità |
1.13g/cm3 |
| Punto di ebollizione |
315.9°C at 760 mmHg |
| Indice di rifrazione |
1.587 |
| Punto d'infiammabilità |
144.9°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
