ChemNet > CAS > 5033-28-3 4-chloro-N'-hydroxybenzenecarboximidamide
5033-28-3 4-chloro-N'-hydroxybenzenecarboximidamide
| Nome del prodotto |
4-chloro-N'-hydroxybenzenecarboximidamide |
| Nome inglese |
4-chloro-N'-hydroxybenzenecarboximidamide; (Z)-4-chloro-N'-hydroxybenzamidine |
| Formula molecolare |
C7H7ClN2O |
| Peso Molecolare |
170.5963 |
| InChI |
InChI=1/C7H7ClN2O/c8-6-3-1-5(2-4-6)7(9)10-11/h1-4,11H,(H2,9,10) |
| Numero CAS |
5033-28-3 |
| Struttura molecolare |
|
| Densità |
1.368g/cm3 |
| Punto di fusione |
129℃ |
| Punto di ebollizione |
334.619°C at 760 mmHg |
| Indice di rifrazione |
1.6 |
| Punto d'infiammabilità |
156.172°C |
| Pressione di vapore |
0mmHg at 25°C |
| Simboli di pericolo |
Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|