ChemNet > CAS > 54932-72-8 5-Bromo-2-chlorotoluene
54932-72-8 5-Bromo-2-chlorotoluene
| Nome del prodotto |
5-Bromo-2-chlorotoluene |
| Sinonimi |
4-bromo-1-chloro-2-methylbenzene |
| Formula molecolare |
C7H6BrCl |
| Peso Molecolare |
205.4795 |
| InChI |
InChI=1/C7H6BrCl/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| Numero CAS |
54932-72-8 |
| Struttura molecolare |
|
| Densità |
1.535g/cm3 |
| Punto di ebollizione |
216.9°C at 760 mmHg |
| Indice di rifrazione |
1.566 |
| Punto d'infiammabilità |
99.1°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
