100-80-1 m-Vinyltoluene
상품명칭 |
m-Vinyltoluene |
영문 이름 |
m-Vinyltoluene; 3-Methylstyrene; 3-Vinyltoluene |
분자식 |
C9H10 |
분자량 |
118.17 |
InChI |
InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
cas번호 |
100-80-1 |
EC번호 |
202-889-2 |
분자 구조 |
|
밀도 |
170 |
비등점 |
171℃ |
리스크 규칙 |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|