ChemNet > CAS > 13029-09-9 2,2'-Dibromobiphenyl
13029-09-9 2,2'-Dibromobiphenyl
상품명칭 |
2,2'-Dibromobiphenyl |
별명 |
2,2-Dibromophenyl; 2,2-Dibromobiphenyl; 2,2'-dibromodiphenyl; 2,2'-Dibromo-1,1'-Biphenyl |
분자식 |
C12H8Br2 |
분자량 |
311.9999 |
InChI |
InChI=1/C12H8Br2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
cas번호 |
13029-09-9 |
분자 구조 |
|
밀도 |
1.667g/cm3 |
녹는 점 |
79℃ |
비등점 |
332.9°C at 760 mmHg |
굴절 지수 |
1.625 |
인화점 |
180°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|