ChemNet > CAS > 132741-30-1 2,4-difluoromandelic acid
132741-30-1 2,4-difluoromandelic acid
상품명칭 |
2,4-difluoromandelic acid |
영문 이름 |
2,4-difluoromandelic acid; alpha-Hydroxy-2,4-difluorophenylacetic acid; 2,4-difluoro mandelic acid; (2,4-difluorophenyl)(hydroxy)acetic acid; (2S)-(2,4-difluorophenyl)(hydroxy)ethanoate; (2R)-(2,4-difluorophenyl)(hydroxy)ethanoate |
분자식 |
C8H5F2O3 |
분자량 |
187.1209 |
InChI |
InChI=1/C8H6F2O3/c9-4-1-2-5(6(10)3-4)7(11)8(12)13/h1-3,7,11H,(H,12,13)/p-1/t7-/m1/s1 |
cas번호 |
132741-30-1 |
분자 구조 |
|
비등점 |
306.5°C at 760 mmHg |
인화점 |
139.1°C |
증기압 |
0.000336mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|