ChemNet > CAS > 1722-10-7 3-Chloro-6-methoxypyridazine
1722-10-7 3-Chloro-6-methoxypyridazine
상품명칭 |
3-Chloro-6-methoxypyridazine |
분자식 |
C5H5ClN2O |
분자량 |
144.559 |
InChI |
InChI=1/C5H5ClN2O/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3 |
cas번호 |
1722-10-7 |
EC번호 |
217-019-7 |
분자 구조 |
|
밀도 |
1.292g/cm3 |
녹는 점 |
85-92℃ |
비등점 |
284.9°C at 760 mmHg |
굴절 지수 |
1.52 |
인화점 |
126.1°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|