ChemNet > CAS > 19250-09-0 1-(3,4-Dichlorophenyl)-2-thiourea
19250-09-0 1-(3,4-Dichlorophenyl)-2-thiourea
상품명칭 |
1-(3,4-Dichlorophenyl)-2-thiourea |
별명 |
3,4-Dichlorophenylthiourea; 1-(3,4-dichlorophenyl)thiourea |
분자식 |
C7H6Cl2N2S |
분자량 |
221.1069 |
InChI |
InChI=1/C7H6Cl2N2S/c8-5-2-1-4(3-6(5)9)11-7(10)12/h1-3H,(H3,10,11,12) |
cas번호 |
19250-09-0 |
EC번호 |
242-919-1 |
분자 구조 |
|
밀도 |
1.563g/cm3 |
녹는 점 |
210-213℃ |
비등점 |
327.7°C at 760 mmHg |
굴절 지수 |
1.73 |
인화점 |
152°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|