ChemNet > CAS > 192702-01-5 3-Chloro-4-fluorobenzyl bromide
192702-01-5 3-Chloro-4-fluorobenzyl bromide
상품명칭 |
3-Chloro-4-fluorobenzyl bromide |
별명 |
alpha-Bromo-3-chloro-4-fluorotoluene; 4-(bromomethyl)-2-chloro-1-fluorobenzene |
분자식 |
C7H5BrClF |
분자량 |
223.47 |
InChI |
InChI=1/C7H5BrClF/c8-4-5-1-2-7(10)6(9)3-5/h1-3H,4H2 |
cas번호 |
192702-01-5 |
분자 구조 |
|
밀도 |
1.654g/cm3 |
비등점 |
235°C at 760 mmHg |
굴절 지수 |
1.561 |
인화점 |
95.9°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
R36:Irritating to eyes.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|