ChemNet > CAS > 199866-90-5 1,4-difluoro-2,5-dimethoxybenzene
199866-90-5 1,4-difluoro-2,5-dimethoxybenzene
상품명칭 |
1,4-difluoro-2,5-dimethoxybenzene |
영문 이름 |
1,4-difluoro-2,5-dimethoxybenzene; |
분자식 |
C8H8F2O2 |
분자량 |
174.1447 |
InChI |
InChI=1/C8H8F2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
cas번호 |
199866-90-5 |
분자 구조 |
|
밀도 |
1.193g/cm3 |
비등점 |
193.7°C at 760 mmHg |
굴절 지수 |
1.455 |
인화점 |
77.4°C |
증기압 |
0.64mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|