ChemNet > CAS > 206559-57-1 2,5-difluorophenyl isothiocyanate
206559-57-1 2,5-difluorophenyl isothiocyanate
| 상품명칭 |
2,5-difluorophenyl isothiocyanate |
| 별명 |
1,4-difluoro-2-isocyanatobenzene |
| 분자식 |
C7H3F2NO |
| 분자량 |
155.1016 |
| InChI |
InChI=1/C7H3F2NO/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
| cas번호 |
206559-57-1 |
| 분자 구조 |
|
| 밀도 |
1.24g/cm3 |
| 비등점 |
181.1°C at 760 mmHg |
| 굴절 지수 |
1.488 |
| 인화점 |
56.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
