ChemNet > CAS > 207974-19-4 2,3-difluoromandelic acid
207974-19-4 2,3-difluoromandelic acid
상품명칭 |
2,3-difluoromandelic acid |
영문 이름 |
2,3-difluoromandelic acid; alpha-Hydroxy-2,3-difluorophenylacetic acid; (2,3-difluorophenyl)(hydroxy)acetic acid |
분자식 |
C8H6F2O3 |
분자량 |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-5-3-1-2-4(6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
cas번호 |
207974-19-4 |
분자 구조 |
|
밀도 |
1.522g/cm3 |
비등점 |
313.3°C at 760 mmHg |
굴절 지수 |
1.542 |
인화점 |
143.3°C |
증기압 |
0.000213mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|