2142-70-3 2-Iodoacetophenone
상품명칭 |
2-Iodoacetophenone |
영문 이름 |
2-Iodoacetophenone; 2'-iodoacetophenone; 1-(2-iodophenyl)ethanone; Iodoacetophenone, 2'- |
분자식 |
C8H7IO |
분자량 |
246.045 |
InChI |
InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
cas번호 |
2142-70-3 |
분자 구조 |
|
밀도 |
1.72g/cm3 |
비등점 |
268.2°C at 760 mmHg |
굴절 지수 |
1.603 |
인화점 |
116°C |
증기압 |
0.00779mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|