ChemNet > CAS > 2144-37-8 Methyl 5-(chloromethyl)-2-furoate
2144-37-8 Methyl 5-(chloromethyl)-2-furoate
| 상품명칭 |
Methyl 5-(chloromethyl)-2-furoate |
| 별명 |
methyl 5-(chloromethyl)furan-2-carboxylate; 5-CHLOROMETHYL-FURAN-2-CARBOXYLIC ACID METHYL ESTER |
| 분자식 |
C7H7ClO3 |
| 분자량 |
174.5817 |
| InChI |
InChI=1/C7H7ClO3/c1-10-7(9)6-3-2-5(4-8)11-6/h2-3H,4H2,1H3 |
| cas번호 |
2144-37-8 |
| EC번호 |
218-405-8 |
| 분자 구조 |
|
| 밀도 |
1.266g/cm3 |
| 녹는 점 |
31℃ |
| 비등점 |
268.2°C at 760 mmHg |
| 굴절 지수 |
1.493 |
| 인화점 |
116°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
