ChemNet > CAS > 21966-60-9 (R)-1,2,3,4-Tetrahydro-1-naphthylamine
21966-60-9 (R)-1,2,3,4-Tetrahydro-1-naphthylamine
| 상품명칭 |
(R)-1,2,3,4-Tetrahydro-1-naphthylamine |
| 영문 이름 |
(R)-1,2,3,4-Tetrahydro-1-naphthylamine; (R)-2-Amino-1,2,3,4-tetrahydronaphthalene; (R)-1-Aminotetraline; (R)-2-AMINOTETRALIN; (R)-(+)-2-AMINOTETRALIN; (2R)-1,2,3,4-tetrahydronaphthalen-2-amine |
| 분자식 |
C10H13N |
| 분자량 |
147.2169 |
| InChI |
InChI=1/C10H13N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10H,5-7,11H2/t10-/m1/s1 |
| cas번호 |
21966-60-9 |
| 분자 구조 |
|
| 밀도 |
1.023g/cm3 |
| 비등점 |
250.7°C at 760 mmHg |
| 굴절 지수 |
1.561 |
| 인화점 |
111.6°C |
| 증기압 |
0.0214mmHg at 25°C |
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|