ChemNet > CAS > 395-81-3 5-fluoro-2-nitrobenzaldehyde
395-81-3 5-fluoro-2-nitrobenzaldehyde
상품명칭 |
5-fluoro-2-nitrobenzaldehyde |
영문 이름 |
5-fluoro-2-nitrobenzaldehyde; 2-Nitro-5-Fluorobenzaldehyde; 5-Fluoro-2-nitrobenzadehyde |
분자식 |
C8H7FO3 |
분자량 |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4H,1H3,(H,10,11) |
cas번호 |
395-81-3 |
EC번호 |
206-903-8 |
분자 구조 |
|
밀도 |
1.307g/cm3 |
녹는 점 |
92-94℃ |
비등점 |
266.9°C at 760 mmHg |
굴절 지수 |
1.524 |
인화점 |
115.2°C |
증기압 |
0.00419mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|