ChemNet > CAS > 41200-96-8 2,4-Dichloro-5-isopropoxyaniline
41200-96-8 2,4-Dichloro-5-isopropoxyaniline
상품명칭 |
2,4-Dichloro-5-isopropoxyaniline |
별명 |
2,4-dichloro-5-(propan-2-yloxy)aniline |
분자식 |
C9H11Cl2NO |
분자량 |
220.0957 |
InChI |
InChI=1/C9H11Cl2NO/c1-5(2)13-9-4-8(12)6(10)3-7(9)11/h3-5H,12H2,1-2H3 |
cas번호 |
41200-96-8 |
EC번호 |
255-258-9 |
분자 구조 |
|
밀도 |
1.272g/cm3 |
비등점 |
310.8°C at 760 mmHg |
굴절 지수 |
1.562 |
인화점 |
141.8°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|