ChemNet > CAS > 51-18-3 Triethylenemelamine
51-18-3 Triethylenemelamine
| 상품명칭 |
Triethylenemelamine |
| 별명 |
Tretamine; 2,4,6-tri(aziridin-1-yl)-1,3,5-triazine; 2,4,6-Tris(1-aziridinyl)-s-triazine; TEM; 2,4,6-tris(aziridin-1-yl)-1,3,5-triazine |
| 분자식 |
C9H12N6 |
| 분자량 |
204.2318 |
| InChI |
InChI=1/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2 |
| cas번호 |
51-18-3 |
| EC번호 |
200-083-5 |
| 분자 구조 |
|
| 밀도 |
1.617g/cm3 |
| 녹는 점 |
160℃ |
| 비등점 |
430.2°C at 760 mmHg |
| 굴절 지수 |
1.789 |
| 인화점 |
214°C |
| 위험성 표시 |
 T+:Very toxic;
|
| 리스크 규칙 |
R28:Very toxic if swallowed.;
R40:Possible risks of irreversible effects.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
