ChemNet > CAS > 5619-05-6 dl-valine methyl ester hcl
5619-05-6 dl-valine methyl ester hcl
상품명칭 |
dl-valine methyl ester hcl |
영문 이름 |
dl-valine methyl ester hcl; DL-Valine methyl ester hydrochloride; H-DL-Val-OMe.HCl; methyl L-valinate hydrochloride (1:1); methyl valinate; N-[4-({(E)-2-cyano-2-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]ethenyl}amino)phenyl]acetamide; valine, chloride, methyl ester; 1-methoxy-3-methyl-1-oxobutan-2-aminium chloride; H-DL-Val-OMe・HCl |
분자식 |
C6H14ClNO2 |
분자량 |
167.6339 |
InChI |
InChI=1/C6H13NO2.ClH/c1-4(2)5(7)6(8)9-3;/h4-5H,7H2,1-3H3;1H |
cas번호 |
5619-05-6 |
EC번호 |
227-048-7 |
분자 구조 |
|
비등점 |
145.7°C at 760 mmHg |
인화점 |
20.7°C |
증기압 |
4.8mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|