613-12-7 2-Methylanthracene
상품명칭 |
2-Methylanthracene |
영문 이름 |
2-Methylanthracene;CCRIS 2739; NSC 87376; Anthracene, 2-methyl- |
분자식 |
C15H12 |
분자량 |
192.2558 |
InChI |
InChI=1/C15H12/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h2-10H,1H3 |
cas번호 |
613-12-7 |
EC번호 |
210-329-3 |
분자 구조 |
|
밀도 |
1.105g/cm3 |
녹는 점 |
202-206℃ |
비등점 |
347.2°C at 760 mmHg |
굴절 지수 |
1.693 |
인화점 |
157.5°C |
증기압 |
0.00011mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|