ChemNet > CAS > 83-24-9 2,5-Dimethyl-1-phenylpyrrole
83-24-9 2,5-Dimethyl-1-phenylpyrrole
상품명칭 |
2,5-Dimethyl-1-phenylpyrrole |
영문 이름 |
2,5-Dimethyl-1-phenylpyrrole;1H-Pyrrole, 2,5-dimethyl-1-phenyl-; NSC 163170; 2,5-Dimethyl-1-phenyl-1H-pyrrole; Pyrrole, 2,5-dimethyl-1-phenyl- (8CI); 1-cyclohexyl-2,5-dimethyl-1H-pyrrole; 2,5-dimethyl-1-phenylpyrrolidine |
분자식 |
C12H17N |
분자량 |
175.2701 |
InChI |
InChI=1/C12H17N/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
cas번호 |
83-24-9 |
EC번호 |
201-461-2 |
분자 구조 |
|
밀도 |
0.952g/cm3 |
녹는 점 |
50-51℃ |
비등점 |
257.7°C at 760 mmHg |
굴절 지수 |
1.519 |
인화점 |
100.2°C |
증기압 |
0.0143mmHg at 25°C |
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|