ChemNet > CAS > 1119-44-4 3-Hepten-2-one
1119-44-4 3-Hepten-2-one
Nama produk |
3-Hepten-2-one |
Sinonim |
AI3-22032; Butylideneacetone; FEMA No. 3400; Methyl pentenyl ketone; (3E)-hept-3-en-2-one |
MF |
C7H12O |
Berat Molekul |
112.1696 |
InChI |
InChI=1/C7H12O/c1-3-4-5-6-7(2)8/h5-6H,3-4H2,1-2H3/b6-5+ |
CAS NO |
1119-44-4 |
EINECS |
214-278-8 |
Struktur Molekul |
|
Kepadatan |
0.832g/cm3 |
Titik didih |
157.8°C at 760 mmHg |
Indeks bias |
1.426 |
Titik nyala |
52.2°C |
Cinta bahaya |
|
Kod Risiko |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|