ChemNet > CAS > 1544-85-0 2,2-difluoro-5-aminobenzodioxole
1544-85-0 2,2-difluoro-5-aminobenzodioxole
| Nama produk |
2,2-difluoro-5-aminobenzodioxole |
| Nama Inggeris |
2,2-difluoro-5-aminobenzodioxole; 2,2-Difluoro-5-amino-1,3-benzodioxole; 2,2-difluorobenzo[d][1,3]dioxol-5-amine; 1-(difluoromethoxy)-4-nitrobenzene; 2,2-Difluoro-5-aminobenzo[d][1,3]dioxole |
| MF |
C7H5F2NO3 |
| Berat Molekul |
189.1163 |
| InChI |
InChI=1/C7H5F2NO3/c8-7(9)13-6-3-1-5(2-4-6)10(11)12/h1-4,7H |
| CAS NO |
1544-85-0 |
| Struktur Molekul |
|
| Kepadatan |
1.384g/cm3 |
| Titik didih |
259.6°C at 760 mmHg |
| Indeks bias |
1.494 |
| Titik nyala |
110.8°C |
| Tekanan wap |
0.0208mmHg at 25°C |
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|