ChemNet > CAS > 226396-32-3 2,3,4-Trifluorophenylboronic acid
226396-32-3 2,3,4-Trifluorophenylboronic acid
Nama produk |
2,3,4-Trifluorophenylboronic acid |
Nama Inggeris |
2,3,4-Trifluorophenylboronic acid; |
MF |
C6H4BF3O2 |
Berat Molekul |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
CAS NO |
226396-32-3 |
Struktur Molekul |
|
Kepadatan |
1.44g/cm3 |
Titik lebur |
229-235℃ |
Titik didih |
260.2°C at 760 mmHg |
Indeks bias |
1.465 |
Titik nyala |
111.2°C |
Tekanan wap |
0.00629mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|