ChemNet > CAS > 2373-89-9 4,4'-Dimethoxychalcone
2373-89-9 4,4'-Dimethoxychalcone
Nama produk |
4,4'-Dimethoxychalcone |
Sinonim |
4,4-Dimethoxybenzylideneacetophenone; 1,3-bis(4-methoxyphenyl)prop-2-en-1-one; (2E)-1,3-bis(4-methoxyphenyl)prop-2-en-1-one |
MF |
C17H16O3 |
Berat Molekul |
268.3071 |
InChI |
InChI=1/C17H16O3/c1-19-15-8-3-13(4-9-15)5-12-17(18)14-6-10-16(20-2)11-7-14/h3-12H,1-2H3/b12-5+ |
CAS NO |
2373-89-9 |
Struktur Molekul |
|
Kepadatan |
1.128g/cm3 |
Titik didih |
444.6°C at 760 mmHg |
Indeks bias |
1.591 |
Titik nyala |
214.6°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|