ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
Nama produk |
Methyl cyclopentanecarboxylate |
Sinonim |
Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate |
MF |
C7H12O2 |
Berat Molekul |
128.169 |
InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
CAS NO |
4630-80-2 |
EINECS |
225-049-7 |
Struktur Molekul |
|
Kepadatan |
1.014g/cm3 |
Titik didih |
159°C at 760 mmHg |
Indeks bias |
1.45 |
Titik nyala |
43.6°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|