ChemNet > CAS > 1073-29-6 2-Hydroxythioanisole
1073-29-6 2-Hydroxythioanisole
| Naam product |
2-Hydroxythioanisole |
| Synoniemen |
2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
| MF |
C7H8OS |
| Molecuulgewicht |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| CAS-nummer |
1073-29-6 |
| EINECS |
214-027-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.19g/cm3 |
| Kookpunt |
206.1°C at 760 mmHg |
| Brekingsindex |
1.613 |
| Vlampunt |
108°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
