ChemNet > CAS > 154607-01-9 4-Bromo-2-chlorobenzonitrile
154607-01-9 4-Bromo-2-chlorobenzonitrile
Naam product |
4-Bromo-2-chlorobenzonitrile |
Synoniemen |
2-Chloro-4-Bromobenzonitrile |
MF |
C7H3BrClN |
Molecuulgewicht |
216.4624 |
InChI |
InChI=1/C7H3BrClN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
CAS-nummer |
154607-01-9 |
Moleculaire Structuur |
|
Dichtheid |
1.74g/cm3 |
Kookpunt |
279.8°C at 760 mmHg |
Brekingsindex |
1.623 |
Vlampunt |
123°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|