ChemNet > CAS > 170572-49-3 3-Fluoro-4-methylbenzonitrile
170572-49-3 3-Fluoro-4-methylbenzonitrile
Naam product |
3-Fluoro-4-methylbenzonitrile |
Engelse naam |
3-Fluoro-4-methylbenzonitrile; 4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
MF |
C8H6FN |
Molecuulgewicht |
135.1383 |
InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
CAS-nummer |
170572-49-3 |
Moleculaire Structuur |
|
Dichtheid |
1.117g/cm3 |
Smeltpunt |
48-50℃ |
Kookpunt |
215.069°C at 760 mmHg |
Brekingsindex |
1.508 |
Vlampunt |
90.3°C |
Dampdruk |
0.151mmHg at 25°C |
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|